Online Database of Chemicals from Around the World
|
CAS#: 29349-67-5 Product: (Tolylsulphonyl)Xylene No suppilers available for the product. |
| Name | (Tolylsulphonyl)Xylene |
|---|---|
| Synonyms | 1,2-Dimethyl-3-(2-Methylphenyl)Sulfonyl-Benzene; (Tolylsulphonyl)Xylene |
| Molecular Structure |  |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.35 |
| CAS Registry Number | 29349-67-5 |
| EINECS | 249-578-8 |
| SMILES | C1=CC=C(C(=C1C)C)[S](=O)(=O)C2=CC=CC=C2C |
| InChI | 1S/C15H16O2S/c1-11-8-6-10-15(13(11)3)18(16,17)14-9-5-4-7-12(14)2/h4-10H,1-3H3 |
| InChIKey | FCZRXPGPBHXENV-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.896°C at 760 mmHg (Cal.) |
| Flash point | 261.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Tolylsulphonyl)Xylene |