Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (2R)-2-Indolinecarboxylate |
|---|---|
| Synonyms | (R)-methyl indoline-2-carboxylate; ZINC04271863 |
| Molecular Structure |  |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 |
| CAS Registry Number | 293737-30-1 |
| SMILES | O=C(OC)[C@@H]2Nc1ccccc1C2 |
| InChI | 1S/C10H11NO2/c1-13-10(12)9-6-7-4-2-3-5-8(7)11-9/h2-5,9,11H,6H2,1H3/t9-/m1/s1 |
| InChIKey | URORFKDEPJFPOV-SECBINFHSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.759°C at 760 mmHg (Cal.) |
| Flash point | 130.856°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2R)-2-Indolinecarboxylate |