Online Database of Chemicals from Around the World
|
CAS#: 2939-80-2 Product: cis-N-(1,1,2,2-Tetrachloroethylthio)-4-cyclohexene-1,2-dicarboximide No suppilers available for the product. |
| Name | cis-N-(1,1,2,2-Tetrachloroethylthio)-4-cyclohexene-1,2-dicarboximide |
|---|---|
| Synonyms | 2-(1,1,2,2-Tetrachloroethylthio)-3A,4,7,7A-Tetrahydroisoindole-1,3-Dione; 2-(1,1,2,2-Tetrachloroethylthio)-3A,4,7,7A-Tetrahydroisoindole-1,3-Quinone; Ortho Difolatan 80W |
| Molecular Structure |  |
| Molecular Formula | C10H9Cl4NO2S |
| Molecular Weight | 349.06 |
| CAS Registry Number | 2939-80-2 |
| SMILES | O=C1N(SC(Cl)(Cl)C(Cl)Cl)C(=O)C2C1CC=CC2 |
| InChI | 1S/C10H9Cl4NO2S/c11-9(12)10(13,14)18-15-7(16)5-3-1-2-4-6(5)8(15)17/h1-2,5-6,9H,3-4H2 |
| InChIKey | JHRWWRDRBPCWTF-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.7±52.0°C at 760 mmHg (Cal.) |
| Flash point | 175.0±30.7°C (Cal.) |
| solubility | 0.0001% |
| Market Analysis Reports |
| List of Reports Available for cis-N-(1,1,2,2-Tetrachloroethylthio)-4-cyclohexene-1,2-dicarboximide |