| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Ester amino acid |
|---|---|
| Name | Ethyl 5-Amino-1H-Benzimidazole-2-Carboxylate |
| Synonyms | ethyl 5-amino-1H-benzo[d]imidazole-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.21 |
| CAS Registry Number | 294174-58-6 |
| SMILES | CCOC(=O)c1[nH]c2cc(ccc2n1)N |
| InChI | 1S/C10H11N3O2/c1-2-15-10(14)9-12-7-4-3-6(11)5-8(7)13-9/h3-5H,2,11H2,1H3,(H,12,13) |
| InChIKey | IHGIPRHPKWXINN-UHFFFAOYSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.005°C at 760 mmHg (Cal.) |
| Flash point | 214.465°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-Amino-1H-Benzimidazole-2-Carboxylate |