Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 5-Chloro-2-Methylbenzoselenazole |
|---|---|
| Synonyms | 5-Chloro-2-Methylbenzoselenazole; Benzoselenazole, 5-Chloro-2-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C8H6ClNSe |
| Molecular Weight | 230.56 |
| CAS Registry Number | 2946-15-8 |
| SMILES | [Se]1C(=NC2=C1C=CC(=C2)Cl)C |
| InChI | 1S/C8H6ClNSe/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,1H3 |
| InChIKey | MOOMGZFKTVIFAB-UHFFFAOYSA-N |
| Boiling point | 270.76°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 117.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-Methylbenzoselenazole |