Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (2E)-3-(4-Ethoxy-3-Methylphenyl)Acrylate |
|---|---|
| Synonyms | (E)-methyl 3-(4-ethoxy-3-methylphenyl)acrylate |
| Molecular Structure |  |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26 |
| CAS Registry Number | 294860-63-2 |
| SMILES | CCOc1ccc(cc1C)/C=C/C(=O)OC |
| InChI | 1S/C13H16O3/c1-4-16-12-7-5-11(9-10(12)2)6-8-13(14)15-3/h5-9H,4H2,1-3H3/b8-6+ |
| InChIKey | AMJSZHYGSCXKIZ-SOFGYWHQSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.086°C at 760 mmHg (Cal.) |
| Flash point | 138.467°C (Cal.) |
| Refractive index | 1.536 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2E)-3-(4-Ethoxy-3-Methylphenyl)Acrylate |