| Alsachim SAS | France | Inquire | ||
|---|---|---|---|---|
![]() |
+33 (368) 240-080 | |||
![]() |
contact@alsachim.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4-Chlorophenyl Trifluoromethanesulfonate |
|---|---|
| Synonyms | 4-chlorophenyl (trifluoromethyl)sulfonate; 4-Chlorophenyl triflate; 4-Chlorophenyl triflate. |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4ClF3O3S |
| Molecular Weight | 260.62 |
| CAS Registry Number | 29540-84-9 |
| SMILES | C1=CC(=CC=C1OS(=O)(=O)C(F)(F)F)Cl |
| InChI | 1S/C7H4ClF3O3S/c8-5-1-3-6(4-2-5)14-15(12,13)7(9,10)11/h1-4H |
| InChIKey | NIIJLHLBNABUFL-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.6±40.0°C at 760 mmHg (Cal.) |
| Flash point | 110°C (Expl.) |
| 117.4±27.3°C (Cal.) | |
| Refractive index | 1.491 (Cal.) |
| Safety Description | S24/25,S36/37/39,S45 |
|---|---|
| R36/37/38 | |
| Irritant | |
| SDS | Available |
| (1) | Farhad Karimi and Bengt Långström. Palladium-mediated carboxylation of aryl halides (triflates) or benzyl halides using [C]/[C]carbon monoxide with tetrabutylammonium hydroxide or trimethylphenylammonium hydroxide, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 2256. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Chlorophenyl Trifluoromethanesulfonate |