Online Database of Chemicals from Around the World
|
CAS#: 29633-99-6 Product: N-Acetylphenylglycine No suppilers available for the product. |
| Name | N-Acetylphenylglycine |
|---|---|
| Synonyms | 2-Acetamido-2-Phenyl-Acetic Acid; 2-Acetamido-2-Phenyl-Ethanoic Acid |
| Molecular Structure |  |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 29633-99-6 |
| EINECS | 240-098-4 |
| SMILES | C1=CC=CC=C1C(NC(C)=O)C(O)=O |
| InChI | 1S/C10H11NO3/c1-7(12)11-9(10(13)14)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,11,12)(H,13,14) |
| InChIKey | VKDFZMMOLPIWQQ-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.177°C at 760 mmHg (Cal.) |
| Flash point | 219.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetylphenylglycine |