Online Database of Chemicals from Around the World
| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
 | www.hoffmanchemicals.com | |||
 | +61 3-7003-5401 | |||
 | info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 3-Acetyldibenzofuran |
|---|---|
| Synonyms | 1-Dibenzofuran-3-ylethanone |
| Molecular Structure |  |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 29640-76-4 |
| SMILES | CC(=O)C1=CC2=C(C=C1)C3=CC=CC=C3O2 |
| Solubility | 387.9 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.0 g/cm3, Calc.* |
| Index of Refraction | 1.670, Calc.* |
| Melting point | 95.46 °C |
| Boiling Point | 325.59 °C, 361.6±0.0 °C (760 mmHg), Calc.* |
| Flash Point | 170.8±0.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3-Acetyldibenzofuran |