Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(4-Fluorophenyl)-1,3-Butanedione |
|---|---|
| Synonyms | (Z)-4-(4-Fluorophenyl)-4-Hydroxybut-3-En-2-One; 4-(4-Fluorophenyl)-4-Hydroxy-But-3-En-2-One; (Z)-4-(4-Fluorophenyl)-4-Hydroxy-But-3-En-2-One |
| Molecular Structure |  |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 |
| CAS Registry Number | 29681-98-9 |
| SMILES | C1=C(\C(O)=C\C(=O)C)C=CC(=C1)F |
| InChI | 1S/C10H9FO2/c1-7(12)6-10(13)8-2-4-9(11)5-3-8/h2-6,13H,1H3/b10-6- |
| InChIKey | NVKHIXOPLVAELL-POHAHGRESA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.923°C at 760 mmHg (Cal.) |
| Flash point | 143.655°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Fluorophenyl)-1,3-Butanedione |