Online Database of Chemicals from Around the World
|
CAS#: 29708-82-5 Product: Grayanotoxane-3beta,5,6beta,7alpha,10,16-Hexol No suppilers available for the product. |
| Name | Grayanotoxane-3beta,5,6beta,7alpha,10,16-Hexol |
|---|---|
| Synonyms | Dihydrolyoniol-B; Grayanotoxane-3,5,6,7,10,16-Hexol, (3-Beta,6-Beta,7-Alpha)-; Lyoniatoxin, Dihydrodeacetyl- |
| Molecular Structure |  |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 |
| CAS Registry Number | 29708-82-5 |
| SMILES | [C@H]12[C@@](O)(C([C@@H](O)C1)(C)C)[C@H](O)[C@@H](O)C34[C@H]([C@]2(O)C)CC[C@@H](C3)[C@](O)(C4)C |
| InChI | 1S/C20H34O6/c1-16(2)13(21)7-12-18(4,25)11-6-5-10-8-19(11,9-17(10,3)24)14(22)15(23)20(12,16)26/h10-15,21-26H,5-9H2,1-4H3/t10-,11-,12-,13-,14+,15+,17+,18+,19?,20-/m0/s1 |
| InChIKey | MZWHHKYLYHLLHP-IPYUSOFXSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.129°C at 760 mmHg (Cal.) |
| Flash point | 240.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Grayanotoxane-3beta,5,6beta,7alpha,10,16-Hexol |