|
CAS#: 2972-65-8 Product: 2,4-Diphenoxy-6-Chloro-1,3,5-Triazine No suppilers available for the product. |
| Name | 2,4-Diphenoxy-6-Chloro-1,3,5-Triazine |
|---|---|
| Synonyms | 2-Chloro-4,6-Bis(Phenoxy)-S-Triazine; Nsc76483; 2-Chloro-4,6-Diphenoxy-S-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 |
| CAS Registry Number | 2972-65-8 |
| SMILES | C3=C(OC1=NC(=NC(=N1)OC2=CC=CC=C2)Cl)C=CC=C3 |
| InChI | 1S/C15H10ClN3O2/c16-13-17-14(20-11-7-3-1-4-8-11)19-15(18-13)21-12-9-5-2-6-10-12/h1-10H |
| InChIKey | WPAYYYDSSCOEHN-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.02°C at 760 mmHg (Cal.) |
| Flash point | 244.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diphenoxy-6-Chloro-1,3,5-Triazine |