| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 1-Isocyano-2,3-Dimethylbenzene |
|---|---|
| Synonyms | 2,3-Dimethylphenylisocyanide; InChI=1/C9H9N/c1-7-5-4-6-9(10-3)8(7)2/h4-6H,1-2H3; xylyl isocyanide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.17 |
| CAS Registry Number | 2980-86-1 |
| SMILES | CC1=C(C(=CC=C1)[N+]#[C-])C |
| InChI | 1S/C9H9N/c1-7-5-4-6-9(10-3)8(7)2/h4-6H,1-2H3 |
| InChIKey | FALDXOCRXXUAHJ-UHFFFAOYSA-N |
| Refractive index | (Cal.) |
|---|---|
| (1) | Rory Waterman and T. Don Tilley. Terminal hafnium phosphinidene complexes and phosphinidene ligand exchange, Chem. Sci., 2011, 2, 1320. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Isocyano-2,3-Dimethylbenzene |