| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Desloratadine EP Impurity A |
|---|---|
| Synonyms | 11-Fluoro Desloratadine;13-chloro-2-fluoro-2-piperidin-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20ClFN2 |
| Molecular Weight | 330.83 |
| CAS Registry Number | 298220-99-2 |
| SMILES | C1CNCCC1C2(C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl)F |
| Solubility | 0.1941 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.615, Calc.* |
| Melting point | 175.26 °C |
| Boiling Point | 420.07 °C, 426.9±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 212.0±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319 Details |
| Safety Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Desloratadine EP Impurity A |