|
CAS#: 29865-52-9 Product: 1-Fluoro-4-(2-Nitropropyl)Benzene No suppilers available for the product. |
| Name | 1-Fluoro-4-(2-Nitropropyl)Benzene |
|---|---|
| Synonyms | (4-FLUOROPHENYL)-2-NITROPROPANE; 1-Fluor-4-(2-nitropropyl)benzol; 1-Fluoro-4-(2-nitropropyl)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 |
| CAS Registry Number | 29865-52-9 |
| SMILES | CC(Cc1ccc(cc1)F)[N+](=O)[O-] |
| InChI | 1S/C9H10FNO2/c1-7(11(12)13)6-8-2-4-9(10)5-3-8/h2-5,7H,6H2,1H3 |
| InChIKey | BOFIUSOZBQKURU-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.8±23.0°C at 760 mmHg (Cal.) |
| Flash point | 119.4±22.6°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Fluoro-4-(2-Nitropropyl)Benzene |