| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | Terbumeton-Desethyl |
| Synonyms | (4-Amino-6-Methoxy-S-Triazin-2-Yl)-Tert-Butyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 |
| CAS Registry Number | 30125-64-5 |
| SMILES | CC(NC1=NC(=NC(=N1)N)OC)(C)C |
| InChI | 1S/C8H15N5O/c1-8(2,3)13-6-10-5(9)11-7(12-6)14-4/h1-4H3,(H3,9,10,11,12,13) |
| InChIKey | HSYISQLUXXBNFW-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.78°C at 760 mmHg (Cal.) |
| Flash point | 175.018°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Terbumeton-Desethyl |