|
CAS#: 30143-22-7 Product: Zinc 2,3,4-Trichlorophenolate No suppilers available for the product. |
| Name | Zinc 2,3,4-Trichlorophenolate |
|---|---|
| Synonyms | Caswell No. 929; Compound-9B; Dow 9-B Seed Protectant |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Cl6O2Zn |
| Molecular Weight | 458.26 |
| CAS Registry Number | 30143-22-7 |
| SMILES | C1=C(C(=C(C(=C1)[O-])Cl)Cl)Cl.C2=C(C(=C(C(=C2)[O-])Cl)Cl)Cl.[Zn++] |
| InChI | 1S/2C6H3Cl3O.Zn/c2*7-3-1-2-4(10)6(9)5(3)8;/h2*1-2,10H;/q;;+2/p-2 |
| InChIKey | LQUPKVMEAATBSL-UHFFFAOYSA-L |
| Boiling point | 260.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 111.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc 2,3,4-Trichlorophenolate |