Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(Tricyclo(5.2.1.0)Decylidene-8)Butanal |
|---|---|
| Synonyms | 4-Tricyclodecylidene Butanal; Butanal, 4-(Octahydro-4,7-Methano-5H-Inden-5-Ylidene)-; Dupical |
| Molecular Structure |  |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 30168-23-1 |
| EINECS | 250-078-7 |
| SMILES | C(C=O)C\C=C/2C1C3C(C(C1)C2)CCC3 |
| InChI | 1S/C14H20O/c15-7-2-1-4-10-8-11-9-14(10)13-6-3-5-12(11)13/h4,7,11-14H,1-3,5-6,8-9H2/b10-4+ |
| InChIKey | WFEISWUNAJPLRX-ONNFQVAWSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.318°C at 760 mmHg (Cal.) |
| Flash point | 150.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Tricyclo(5.2.1.0)Decylidene-8)Butanal |