Online Database of Chemicals from Around the World
|
CAS#: 30220-20-3 Product: 1-(2-Chloroethyl)-2,3,4,5,6-Pentamethylbenzene No suppilers available for the product. |
| Name | 1-(2-Chloroethyl)-2,3,4,5,6-Pentamethylbenzene |
|---|---|
| Synonyms | 1-(2-Chlorethyl)-2,3,4,5,6-pentamethylbenzol; 1-(2-Chloroethyl)-2,3,4,5,6-pentamethylbenzene; 1-(2-Chloroéthyl)-2,3,4,5,6-pentaméthylbenzène |
| Molecular Structure |  |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.74 |
| CAS Registry Number | 30220-20-3 |
| SMILES | Cc1c(c(c(c(c1C)C)CCCl)C)C |
| InChI | 1S/C13H19Cl/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6-7H2,1-5H3 |
| InChIKey | KDQYVOJKSCDMGM-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.6±11.0°C at 760 mmHg (Cal.) |
| Flash point | 138.4±12.0°C (Cal.) |
| Refractive index | 1.514 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chloroethyl)-2,3,4,5,6-Pentamethylbenzene |