Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-deoxy-L-threo-pentofuranoside |
|---|---|
| Synonyms | (2S,3S)-2-(hydroxymethyl)-5-methoxytetrahydrofuran-3-ol |
| Molecular Structure |  |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 |
| CAS Registry Number | 302349-32-2 |
| SMILES | COC1C[C@@H]([C@@H](O1)CO)O |
| InChI | 1S/C6H12O4/c1-9-6-2-4(8)5(3-7)10-6/h4-8H,2-3H2,1H3/t4-,5-,6?/m0/s1 |
| InChIKey | NVGJZDFWPSOTHM-HVYQYDHPSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.492°C at 760 mmHg (Cal.) |
| Flash point | 131.904°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-deoxy-L-threo-pentofuranoside |