Online Database of Chemicals from Around the World
2,2'-(2,5-Difluoro-1,4-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)
[CAS# 303006-90-8]
Identification| Name | 2,2'-(2,5-Difluoro-1,4-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C18H26B2F2O4 |
| Molecular Weight | 366.02 |
| CAS Registry Number | 303006-90-8 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)B3OC(C(O3)(C)C)(C)C)F |
|
Properties
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.476, Calc.* |
| Boiling Point | 419.6±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 207.5±28.7 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
(3,5-Difluoroph... (2,3-Difluoroph... (2,4-Difluoroph... (2,5-Difluoroph... (2,6-Difluoroph... (3,4-Difluoroph... (3,5-Difluoroph... 3-(2,4-Difluoro... 2-(2,5-Difluoro... 2-(2,4-Difluoro... 3,4-Difluorophe... 2,4-Difluoro-1,... 1-[2-(2,4-Diflu... 2-(3,4-Difluoro... (1S)-1-(3,4-Dif... 2,2-Difluoro-2-... 1-(2,4-Difluoro... 1-(2,5-Difluoro... (S)-1-(3,5-Difl... (R)-1-(3,5-Difl...