Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Fluoro-4-Nitropyridine 1-Oxide |
|---|---|
| Synonyms | 2-fluoro-4-nitropyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C5H3FN2O3 |
| Molecular Weight | 158.09 |
| CAS Registry Number | 303154-01-0 |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])c(F)c1 |
| InChI | 1S/C5H3FN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3H |
| InChIKey | LZUKYBVQIXLJLK-UHFFFAOYSA-N |
| Density | 1.569g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.668°C at 760 mmHg (Cal.) |
| Flash point | 195.513°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-4-Nitropyridine 1-Oxide |