Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(4,6-Dichloro-1,3,5-Triazin-2-Yl)Benzenesulphonamide |
|---|---|
| Synonyms | N-(4,6-Dichloro-S-Triazin-2-Yl)Benzenesulfonamide; N-(4,6-Dichloro-S-Triazin-2-Yl)Benzenesulfonam* |
| Molecular Structure |  |
| Molecular Formula | C9H6Cl2N4O2S |
| Molecular Weight | 305.14 |
| CAS Registry Number | 30369-89-2 |
| EINECS | 250-155-5 |
| SMILES | C1=CC=CC=C1[S](NC2=NC(=NC(=N2)Cl)Cl)(=O)=O |
| InChI | 1S/C9H6Cl2N4O2S/c10-7-12-8(11)14-9(13-7)15-18(16,17)6-4-2-1-3-5-6/h1-5H,(H,12,13,14,15) |
| InChIKey | ALNLGFPQRQFZBP-UHFFFAOYSA-N |
| Density | 1.675g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.391°C at 760 mmHg (Cal.) |
| Flash point | 283.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4,6-Dichloro-1,3,5-Triazin-2-Yl)Benzenesulphonamide |