|
CAS#: 30408-30-1 Product: 8-(Hydroxymethyl)-6,11-Dimethyl-4H-[1,3]Oxazolo[5,4,3-ij]Pyrido[3,2-g]Quinoline-4,10(11H)-Dione No suppilers available for the product. |
| Name | 8-(Hydroxymethyl)-6,11-Dimethyl-4H-[1,3]Oxazolo[5,4,3-ij]Pyrido[3,2-g]Quinoline-4,10(11H)-Dione |
|---|---|
| Synonyms | Aids-130803; Aids130803; Nsc613948 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 |
| CAS Registry Number | 30408-30-1 |
| SMILES | C2=C1C(=CC(N(C1=C4C3=C2C(=CC(N3CO4)=O)C)C)=O)CO |
| InChI | 1S/C16H14N2O4/c1-8-3-13(21)18-7-22-16-14-11(5-10(8)15(16)18)9(6-19)4-12(20)17(14)2/h3-5,19H,6-7H2,1-2H3 |
| InChIKey | HKMUGCUFXWTNSP-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.7±50.0°C at 760 mmHg (Cal.) |
| Flash point | 279.6±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-(Hydroxymethyl)-6,11-Dimethyl-4H-[1,3]Oxazolo[5,4,3-ij]Pyrido[3,2-g]Quinoline-4,10(11H)-Dione |