|
CAS#: 304854-36-2 Product: 6-(3-Methoxyphenyl)-4,4-Dimethyl-1,4-Dihydro-2H-3,1-Benzoxazin-2-One No suppilers available for the product. |
| Name | 6-(3-Methoxyphenyl)-4,4-Dimethyl-1,4-Dihydro-2H-3,1-Benzoxazin-2-One |
|---|---|
| Synonyms | 2H-3,1-BE |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32 |
| CAS Registry Number | 304854-36-2 |
| SMILES | CC1(C2=C(C=CC(=C2)C3=CC(=CC=C3)OC)NC(=O)O1)C |
| InChI | 1S/C17H17NO3/c1-17(2)14-10-12(7-8-15(14)18-16(19)21-17)11-5-4-6-13(9-11)20-3/h4-10H,1-3H3,(H,18,19) |
| InChIKey | XCKPZLTYDJLOFR-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 185.4±27.9°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(3-Methoxyphenyl)-4,4-Dimethyl-1,4-Dihydro-2H-3,1-Benzoxazin-2-One |