Online Database of Chemicals from Around the World
| Name | 2-Chlorosulfonylbenzenesulfonyl Fluoride |
|---|---|
| Synonyms | 2-Fluorosulphonylbenzenesulphonyl Chloride; Nsc137843 |
| Molecular Structure |  |
| Molecular Formula | C6H4ClFO4S2 |
| Molecular Weight | 258.67 |
| CAS Registry Number | 30672-70-9 |
| EINECS | 250-277-9 |
| SMILES | C1=CC=CC(=C1[S](=O)(=O)F)[S](=O)(=O)Cl |
| InChI | 1S/C6H4ClFO4S2/c7-13(9,10)5-3-1-2-4-6(5)14(8,11)12/h1-4H |
| InChIKey | UHOQOZLYSJNPJR-UHFFFAOYSA-N |
| Density | 1.65g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.617°C at 760 mmHg (Cal.) |
| Flash point | 167.662°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Chlorosulfonylbenzenesulfonyl Fluoride |
