Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Diethyl trans-Cyclopentane-1,2-Dicarboxylate |
|---|---|
| Synonyms | (1S,2S)-Cyclopentane-1,2-Dicarboxylic Acid Diethyl Ester; Diethyl Trans-Cyclopentane-1,2-Dicarboxylate |
| Molecular Structure |  |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 30689-38-4 |
| EINECS | 250-296-2 |
| SMILES | [C@H]1([C@@H](C(=O)OCC)CCC1)C(=O)OCC |
| InChI | 1S/C11H18O4/c1-3-14-10(12)8-6-5-7-9(8)11(13)15-4-2/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | YLRALQSVMCXBSD-IUCAKERBSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.48°C at 760 mmHg (Cal.) |
| Flash point | 130.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl trans-Cyclopentane-1,2-Dicarboxylate |