Online Database of Chemicals from Around the World
|
CAS#: 307-49-3 Product: Tetracosafluoroundecane No suppilers available for the product. |
| Name | Tetracosafluoroundecane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C11F24 |
| Molecular Weight | 588.08 |
| CAS Registry Number | 307-49-3 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C11F24/c12-1(13,2(14,15)4(18,19)6(22,23)8(26,27)10(30,31)32)3(16,17)5(20,21)7(24,25)9(28,29)11(33,34)35 |
| InChIKey | VCIVYCHKSHULON-UHFFFAOYSA-N |
| Density | 1.723g/cm3 (Cal.) |
|---|---|
| Boiling point | 172.658°C at 760 mmHg (Cal.) |
| Flash point | 66.613°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetracosafluoroundecane |