Online Database of Chemicals from Around the World
|
CAS#: 3088-17-3 Product: 1,4-Bis(Ethenylsulfonyl)Butane No suppilers available for the product. |
| Name | 1,4-Bis(Ethenylsulfonyl)Butane |
|---|---|
| Synonyms | 1,4-Bis(Vinylsulfonyl)Butane; 1-(4-Vinylsulfonylbutylsulfonyl)Ethylene; Butane, 1,4-Bis(Ethenylsulfonyl)- |
| Molecular Structure |  |
| Molecular Formula | C8H14O4S2 |
| Molecular Weight | 238.32 |
| CAS Registry Number | 3088-17-3 |
| SMILES | C([S](C=C)(=O)=O)CCC[S](C=C)(=O)=O |
| InChI | 1S/C8H14O4S2/c1-3-13(9,10)7-5-6-8-14(11,12)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | HGLPVMBQJHDEJY-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.666°C at 760 mmHg (Cal.) |
| Flash point | 328.39°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(Ethenylsulfonyl)Butane |