Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (203) 315-5062 / (877) 786-1922 | |||
|
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Name | Tert-Butyl 2,3-Dioxobutanoate |
|---|---|
| Synonyms | 2,3-dioxo-butyric acid tert-butyl ester; 2,3-DIOXO-BUTYRICACIDTERT-BUTYLESTER; tert-Butyl 2,3-dioxobutanoate |
| Molecular Structure |  |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 31108-35-7 |
| SMILES | O=C(C(=O)OC(C)(C)C)C(C)=O |
| InChI | 1S/C8H12O4/c1-5(9)6(10)7(11)12-8(2,3)4/h1-4H3 |
| InChIKey | LRUWQFVUXMRECG-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.872°C at 760 mmHg (Cal.) |
| Flash point | 90.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl 2,3-Dioxobutanoate |