|
CAS#: 3111-70-4 Product: 1-Methyl-4-(3-(2-Chloro-Phenothiazin-10-Yl)Propyl)-Piperazine Hydrogen Methanesulfonate No suppilers available for the product. |
| Name | 1-Methyl-4-(3-(2-Chloro-Phenothiazin-10-Yl)Propyl)-Piperazine Hydrogen Methanesulfonate |
|---|---|
| Synonyms | Prochlorperazine Hydrogen Methanesulfonate; 2-Chloro-10-(3-(4-Methyl-1-Piperazinyl)Propyl)-10H-Phenothiazine Monomethanesulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28ClN3O3S2 |
| Molecular Weight | 470.04 |
| CAS Registry Number | 3111-70-4 |
| EINECS | 221-473-1 |
| SMILES | C1=C(Cl)C=CC3=C1N(C2=CC=CC=C2S3)CCCN4CCN(CC4)C.C[S](=O)(=O)O |
| InChI | 1S/C20H24ClN3S.CH4O3S/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24;1-5(2,3)4/h2-3,5-8,15H,4,9-14H2,1H3;1H3,(H,2,3,4) |
| InChIKey | WLFCZUKGFJNFQY-UHFFFAOYSA-N |
| Boiling point | 524.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 271.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-(3-(2-Chloro-Phenothiazin-10-Yl)Propyl)-Piperazine Hydrogen Methanesulfonate |