|
CAS#: 31118-38-4 Product: 1,3-Bis(2-Methyl-2-Propanyl)-1,3-Diazetidine-2,4-Dione No suppilers available for the product. |
| Name | 1,3-Bis(2-Methyl-2-Propanyl)-1,3-Diazetidine-2,4-Dione |
|---|---|
| Synonyms | 1,3-di-tert-butyl-1,3-diazetidine-2,4-dione; NSC156206 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.26 |
| CAS Registry Number | 31118-38-4 |
| SMILES | O=C1N(C(=O)N1C(C)(C)C)C(C)(C)C |
| InChI | 1S/C10H18N2O2/c1-9(2,3)11-7(13)12(8(11)14)10(4,5)6/h1-6H3 |
| InChIKey | YNVGSDMMTJGWRP-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.956°C at 760 mmHg (Cal.) |
| Flash point | 74.85°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(2-Methyl-2-Propanyl)-1,3-Diazetidine-2,4-Dione |