|
CAS#: 31121-37-6 Product: 2,8-Dimethyl-10H-Phenothiaphosphinin-10-Ol 10-Oxide No suppilers available for the product. |
| Name | 2,8-Dimethyl-10H-Phenothiaphosphinin-10-Ol 10-Oxide |
|---|---|
| Synonyms | Phenothiaphosphine, 10-hydroxy-2,8-dimethyl-, 10-oxide; Phenothiaphosphine, 10-hydroxy-2,8-dimethyl-, 10-oxide (8CI); Phenothiaphosphorin, 10-hydroxy-2,8-dimethyl-, 10-oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13O2PS |
| Molecular Weight | 276.29 |
| CAS Registry Number | 31121-37-6 |
| SMILES | O=P2(O)c3c(Sc1c2cc(cc1)C)ccc(c3)C |
| InChI | 1S/C14H13O2PS/c1-9-3-5-13-11(7-9)17(15,16)12-8-10(2)4-6-14(12)18-13/h3-8H,1-2H3,(H,15,16) |
| InChIKey | USFVUQLEAMXHAQ-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.702°C at 760 mmHg (Cal.) |
| Flash point | 282.621°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,8-Dimethyl-10H-Phenothiaphosphinin-10-Ol 10-Oxide |