|
CAS#: 31242-94-1 Product: 1,2-Dichloro-3-(2,4-Dichlorophenoxy)Benzene No suppilers available for the product. |
| Name | 1,2-Dichloro-3-(2,4-Dichlorophenoxy)Benzene |
|---|---|
| Synonyms | Phenyl ether tetrachloro; Tetrachloro diphenyl ether; Tetrachloro diphenyl oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4O |
| Molecular Weight | 307.99 |
| CAS Registry Number | 31242-94-1 |
| SMILES | Clc2c(Oc1ccc(Cl)cc1Cl)cccc2Cl |
| InChI | 1S/C12H6Cl4O/c13-7-4-5-10(9(15)6-7)17-11-3-1-2-8(14)12(11)16/h1-6H |
| InChIKey | UYVBJPIPRAJEKW-UHFFFAOYSA-N |
| Density | 1.482g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.197°C at 760 mmHg (Cal.) |
| Flash point | 122.637°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloro-3-(2,4-Dichlorophenoxy)Benzene |