|
CAS#: 31263-13-5 Product: Bis(4-Methoxyphenyl) (2Z)-2-Butenedioate No suppilers available for the product. |
| Name | Bis(4-Methoxyphenyl) (2Z)-2-Butenedioate |
|---|---|
| Synonyms | Butenedioic acid, bis(p-methoxyphenyl) ester, (E)-; Di-p-methoxyphenyl fumarate; Fumaric acid, bis(p-methoxyphenyl) ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 |
| CAS Registry Number | 31263-13-5 |
| SMILES | O=C(Oc1ccc(OC)cc1)\C=C/C(=O)Oc2ccc(OC)cc2 |
| InChI | 1S/C18H16O6/c1-21-13-3-7-15(8-4-13)23-17(19)11-12-18(20)24-16-9-5-14(22-2)6-10-16/h3-12H,1-2H3/b12-11- |
| InChIKey | GMPXJJLSVLCCHM-QXMHVHEDSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.941°C at 760 mmHg (Cal.) |
| Flash point | 216.276°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Methoxyphenyl) (2Z)-2-Butenedioate |