Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Tris-biphenyl triazine |
|---|---|
| Synonyms | 2,4,6-tri([1,1'-biphenyl]-4-yl)-1,3,5-triazine; 1,3,5-Triazine, 2,4,6-tris[1,1'-biphenyl]-4-yl- |
| Molecular Structure |  |
| Molecular Formula | C39H27N3 |
| Molecular Weight | 537.67 |
| CAS Registry Number | 31274-51-8 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC(=N3)C4=CC=C(C=C4)C5=CC=CC=C5)C6=CC=C(C=C6)C7=CC=CC=C7 |
| InChI | 1S/C39H27N3/c1-4-10-28(11-5-1)31-16-22-34(23-17-31)37-40-38(35-24-18-32(19-25-35)29-12-6-2-7-13-29)42-39(41-37)36-26-20-33(21-27-36)30-14-8-3-9-15-30/h1-27H |
| InChIKey | CENPSTJGQOQKKW-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Expl.) |
|---|---|
| Melting point | 282°C (Expl.) |
| Boiling point | 765.9±70.0°C at 760 mmHg (Expl.) |
| Market Analysis Reports |
| List of Reports Available for Tris-biphenyl triazine |