Online Database of Chemicals from Around the World
| Name | S-(Trichloromethyl) dichloromethanesulfonothioate |
|---|---|
| Synonyms | Methanethiosulfonic acid, dichloro-, S-trichloromethyl ester; Sulfone, dichloromethyl trichloromethylthio; Trichlormethylester kyseliny dichlormethanthiosulfonove |
| Molecular Structure |  |
| Molecular Formula | C2HCl5O2S2 |
| Molecular Weight | 298.42 |
| CAS Registry Number | 31335-41-8 |
| SMILES | ClC(Cl)(Cl)SS(=O)(=O)C(Cl)Cl |
| InChI | 1S/C2HCl5O2S2/c3-1(4)11(8,9)10-2(5,6)7/h1H |
| InChIKey | RTGLSHVKDMQCCC-UHFFFAOYSA-N |
| Density | 1.939g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.588°C at 760 mmHg (Cal.) |
| Flash point | 129.543°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(Trichloromethyl) dichloromethanesulfonothioate |
