|
CAS#: 31366-97-9 Product: Sodium 3-Chloro-4-Biphenylolate No suppilers available for the product. |
| Name | Sodium 3-Chloro-4-Biphenylolate |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4-ol, 3-chloro-, sodium salt; 4-Biphenylol, 3-chloro-, sodium salt; Sodium 2-chloro-4-phenylphenate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClNaO |
| Molecular Weight | 226.63 |
| CAS Registry Number | 31366-97-9 |
| SMILES | [Na+].[O-]c2ccc(c1ccccc1)cc2Cl |
| InChI | 1S/C12H9ClO.Na/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9;/h1-8,14H;/q;+1/p-1 |
| InChIKey | ARCOPJIXLBWKLT-UHFFFAOYSA-M |
| Boiling point | 317.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 145.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 3-Chloro-4-Biphenylolate |