Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Boronal |
|---|---|
| Synonyms | (E)-2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexenyl)But-2-Enal; Beta-C14 Aldehyde; Beta-C14-Aldehyde |
| Molecular Structure |  |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 3155-71-3 |
| EINECS | 221-597-6 |
| SMILES | C(\C=C(C=O)/C)C1=C(CCCC1(C)C)C |
| InChI | 1S/C14H22O/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h7,10H,5-6,8-9H2,1-4H3/b11-7+ |
| InChIKey | FJCQUJKUMKZEMH-YRNVUSSQSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.09°C at 760 mmHg (Cal.) |
| Flash point | 129.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Boronal |