|
CAS#: 31617-39-7 Product: 1,3-Diethyl-7-Methylpurine-2,6-Dione No suppilers available for the product. |
| Name | 1,3-Diethyl-7-Methylpurine-2,6-Dione |
|---|---|
| Synonyms | 1,3-Diethyl-7-Methyl-Purine-2,6-Dione; 1,3-Diethyl-7-Methyl-Xanthine; Heteroxanthine, 1,3-Diethyl- |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 |
| CAS Registry Number | 31617-39-7 |
| SMILES | C1=NC2=C([N]1C)C(=O)N(CC)C(N2CC)=O |
| InChI | 1S/C10H14N4O2/c1-4-13-8-7(12(3)6-11-8)9(15)14(5-2)10(13)16/h6H,4-5H2,1-3H3 |
| InChIKey | WGMHUEQTUNLCNK-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.335°C at 760 mmHg (Cal.) |
| Flash point | 212.245°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diethyl-7-Methylpurine-2,6-Dione |