Online Database of Chemicals from Around the World
| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
 | www.hoffmanchemicals.com | |||
 | +61 3-7003-5401 | |||
 | info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Naphthalen-1-yl(pyrrolidin-1-yl)methanone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 |
| CAS Registry Number | 316804-80-5 |
| SMILES | C1CCN(C1)C(=O)C2=CC=CC3=CC=CC=C32 |
| Solubility | 137.9 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.648, Calc.* |
| Melting point | 127.66 °C |
| Boiling Point | 377.54 °C, 406.3±14.0 °C (760 mmHg), Calc.* |
| Flash Point | 194.0±11.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Naphthalen-1-yl(pyrrolidin-1-yl)methanone |