Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2S)-2-(Chlorocarbonyl)Cyclobutanecarboxylic Acid |
|---|---|
| Synonyms | (1R,2S)-2-(chlorocarbonyl)cyclobutanecarboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C6H7ClO3 |
| Molecular Weight | 162.57 |
| CAS Registry Number | 31838-29-6 |
| SMILES | C1C[C@@H]([C@@H]1C(=O)O)C(=O)Cl |
| InChI | 1S/C6H7ClO3/c7-5(8)3-1-2-4(3)6(9)10/h3-4H,1-2H2,(H,9,10)/t3-,4+/m0/s1 |
| InChIKey | ZYDTUTRMHOVKRQ-IUYQGCFVSA-N |
| Density | 1.487g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.005°C at 760 mmHg (Cal.) |
| Flash point | 126.167°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-(Chlorocarbonyl)Cyclobutanecarboxylic Acid |