Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6-Methylanthanthrene |
|---|---|
| Synonyms | 6-Methylanthanthrene; Brn 1980233; Dibenzo(Def,Mno)Chrysene, 12-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C23H14 |
| Molecular Weight | 290.36 |
| CAS Registry Number | 31927-64-7 |
| SMILES | C4=CC2=CC=CC3=CC1=CC=C6C5=C1C(=C23)C4=C(C)C5=CC=C6 |
| InChI | 1S/C23H14/c1-13-18-7-3-5-15-8-9-17-12-16-6-2-4-14-10-11-19(13)23(20(14)16)22(17)21(15)18/h2-12H,1H3 |
| InChIKey | OEKGRQIOXGBWRE-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.204°C at 760 mmHg (Cal.) |
| Flash point | 254.93°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methylanthanthrene |