Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3-Dihydronaphtho[1,2-b]Furan-4,5-Dione |
|---|---|
| Synonyms | Oxolano(2,3-c)naphthalene-1,2-dione |
| Molecular Structure | ![CAS#: 32013-77-7， 2,3-Dihydronaphtho[1,2-b]Furan-4,5-Dione](/moreStructures/32013-77-7.gif) |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 32013-77-7 |
| SMILES | O=C2c3c(C=1OCCC=1C2=O)cccc3 |
| InChI | 1S/C12H8O3/c13-10-7-3-1-2-4-8(7)12-9(11(10)14)5-6-15-12/h1-4H,5-6H2 |
| InChIKey | SNMIGXQJBKAGDD-UHFFFAOYSA-N |
| Density | 1.389g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.566°C at 760 mmHg (Cal.) |
| Flash point | 169.622°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydronaphtho[1,2-b]Furan-4,5-Dione |