| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Name | 2-(1-Ethylpyrrolidin-3-yl)-2,2-diphenylacetonitrile |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.40 |
| CAS Registry Number | 3212-87-1 |
| SMILES | CCN1CCC(C1)C(C#N)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.575, Calc.* |
| Boiling Point | 417.5±25.0 °C (760 mmHg), Calc.* |
| Flash Point | 173.7±12.4 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Ethylpyrrolidin-3-yl)-2,2-diphenylacetonitrile |