Online Database of Chemicals from Around the World
|
CAS#: 32368-69-7 Product: Nitro Benzenecarboperoxoate No suppilers available for the product. |
| Name | Nitro Benzenecarboperoxoate |
|---|---|
| Synonyms | Benzenecarboperoxoic Acid Nitro Ester; Benzoyl Nitro Peroxide; Brn 2647419 |
| Molecular Structure |  |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.12 |
| CAS Registry Number | 32368-69-7 |
| SMILES | C1=CC=CC=C1C(OO[N+]([O-])=O)=O |
| InChI | 1S/C7H5NO5/c9-7(12-13-8(10)11)6-4-2-1-3-5-6/h1-5H |
| InChIKey | ONDCXZPWEKXYJE-UHFFFAOYSA-N |
| Density | 1.409g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.71°C at 760 mmHg (Cal.) |
| Flash point | 138.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitro Benzenecarboperoxoate |