Online Database of Chemicals from Around the World
|
CAS#: 3246-21-7 Product: (S)-6,7,7a,8-Tetrahydro-4,10,11-Trimethoxy-7-Methyl-5H-Benzo(g)-1,3-Benzodioxolo(6,5,4-De)Quinoline No suppilers available for the product. |
| Name | (S)-6,7,7a,8-Tetrahydro-4,10,11-Trimethoxy-7-Methyl-5H-Benzo(g)-1,3-Benzodioxolo(6,5,4-De)Quinoline |
|---|---|
| Synonyms | Ocotein; Thalicmine |
| Molecular Structure |  |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 |
| CAS Registry Number | 3246-21-7 |
| SMILES | C1=C(C(=CC5=C1C2=C4C(=C(C3=C2OCO3)OC)CCN(C4C5)C)OC)OC |
| InChI | 1S/C21H23NO5/c1-22-6-5-12-17-14(22)7-11-8-15(23-2)16(24-3)9-13(11)18(17)20-21(19(12)25-4)27-10-26-20/h8-9,14H,5-7,10H2,1-4H3 |
| InChIKey | XEZKWYLHAOYOCL-UHFFFAOYSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.451°C at 760 mmHg (Cal.) |
| Flash point | 148.769°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (S)-6,7,7a,8-Tetrahydro-4,10,11-Trimethoxy-7-Methyl-5H-Benzo(g)-1,3-Benzodioxolo(6,5,4-De)Quinoline |