Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (Methylamino-Phosphonomethyl)Phosphonic Acid |
|---|---|
| Synonyms | (Methylamino-Phosphono-Methyl)Phosphonic Acid; ((Methylamino)Methylene)Bisphosphonic Acid |
| Molecular Structure |  |
| Molecular Formula | C2H9NO6P2 |
| Molecular Weight | 205.04 |
| CAS Registry Number | 32545-63-4 |
| EINECS | 251-093-1 |
| SMILES | CNC([P](=O)(O)O)[P](=O)(O)O |
| InChI | 1S/C2H9NO6P2/c1-3-2(10(4,5)6)11(7,8)9/h2-3H,1H3,(H2,4,5,6)(H2,7,8,9) |
| InChIKey | UTRWIBWHXZRMIB-UHFFFAOYSA-N |
| Density | 1.88g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.307°C at 760 mmHg (Cal.) |
| Flash point | 273.311°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Methylamino-Phosphonomethyl)Phosphonic Acid |