Online Database of Chemicals from Around the World
|
CAS#: 3265-86-9 Product: 4,4-Dichloro-12-phenyl-10,11,12-triazapentacyclo[6.5.1.02,7.03,5.09,13]tetradec-10-ene No suppilers available for the product. |
| Name | 4,4-Dichloro-12-phenyl-10,11,12-triazapentacyclo[6.5.1.02,7.03,5.09,13]tetradec-10-ene |
|---|---|
| Molecular Structure | ![CAS#: 3265-86-9， 4,4-Dichloro-12-phenyl-10,11,12-triazapentacyclo[6.5.1.02,7.03,5.09,13]tetradec-10-ene](/moreStructures/3265-86-9.gif) |
| Molecular Formula | C17H17Cl2N3 |
| Molecular Weight | 334.24 |
| CAS Registry Number | 3265-86-9 |
| SMILES | ClC4(Cl)C5C3C2C1N(\N=N/C1C(C2)C3CC45)c6ccccc6 |
| InChI | 1S/C17H17Cl2N3/c18-17(19)12-7-9-10-6-11(13(9)14(12)17)16-15(10)20-21-22(16)8-4-2-1-3-5-8/h1-5,9-16H,6-7H2 |
| InChIKey | ODBOJHQQSKXVFH-UHFFFAOYSA-N |
| Density | 1.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.319°C at 760 mmHg (Cal.) |
| Flash point | 226.145°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dichloro-12-phenyl-10,11,12-triazapentacyclo[6.5.1.02,7.03,5.09,13]tetradec-10-ene |