Online Database of Chemicals from Around the World
|
CAS#: 32740-01-5 Product: 7,11-Dimethylbenzo[c]Acridine No suppilers available for the product. |
| Name | 7,11-Dimethylbenzo[c]Acridine |
|---|---|
| Synonyms | 1,10-Dimethyl-7,8-Benzacridine [French]; 7,11-Dimethylbenz(C)Acridine; Brn 0200567 |
| Molecular Structure | ![CAS#: 32740-01-5， 7,11-Dimethylbenzo[c]Acridine](/moreStructures/32740-01-5.gif) |
| Molecular Formula | C19H15N |
| Molecular Weight | 257.33 |
| CAS Registry Number | 32740-01-5 |
| SMILES | C4=CC=C3C(=C2C=CC1=CC=CC=C1C2=NC3=C4C)C |
| InChI | 1S/C19H15N/c1-12-6-5-9-15-13(2)16-11-10-14-7-3-4-8-17(14)19(16)20-18(12)15/h3-11H,1-2H3 |
| InChIKey | RZVCZQLPQROJFR-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.326°C at 760 mmHg (Cal.) |
| Flash point | 210.381°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,11-Dimethylbenzo[c]Acridine |